Identità
Sulclamide
CAS 2455-92-7 · C7H7ClN2O3S
01Identità
| Lazychem ID | LC-28543 |
|---|---|
| CAS RN | 2455-92-7 |
| PubChem CID | 213020 |
| Molecular formula | C7H7ClN2O3S |
| Molecular weight | 234.65 g/mol |
| IUPAC name | 4-chloro-3-sulfamoylbenzamide |
| InChIKey | WRLKLPDTRUYBBV-UHFFFAOYSA-N |
02Struttura e stereochimica
2D structurePubChem CID 213020

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC(=C(C=C1C(=O)N)S(=O)(=O)N)Cl |
|---|---|
| InChI | Non indicato |
03Stato in India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomi e relazioni
API e farmaco progenitore
Indapamide
Impurezze e composti correlatiNomi e relazioni
- Sulclamide / Indapamide Impurity 2
- Sulclamide
- Indapamide Impurity 2
- 3-(Aminosulfonyl)-4-chlorobenzamide
- 3-Sulfamido-4-chlorobenzamide
- 3-Sulfamoyl-4-chlorobenzamide
- 3-Sulfamyl-4-chlorobenzamide
- 4-Chloro-3-sulfamoylbenzamide
- 4-Chloro-3-sulfamoyl-benzenecarboxamide
- RefChem:186468
- 4-Cl-S-BCA
- 2455-92-7
05Fonti
- S01PubChem CID 213020
Structure and machine-readable chemical identifiers.
