Identità
SMI-4a
Non indicato · C11H6F3NO2S
01Identità
| Lazychem ID | LC-98922 |
|---|---|
| CAS RN | Non indicato |
| PubChem CID | 1361334 |
| Molecular formula | C11H6F3NO2S |
| Molecular weight | 273.23 g/mol |
| IUPAC name | (5Z)-5-[[3-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| InChIKey | NGJLOFCOEOHFKQ-YVMONPNESA-N |
02Struttura e stereochimica
2D structurePubChem CID 1361334

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)/C=C\2/C(=O)NC(=O)S2 |
|---|---|
| InChI | Non indicato |
03Stato in India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomi e relazioni
API e farmaco progenitore
Non indicato
Nomi e relazioni
05Fonti
- S01PubChem CID 1361334
Structure and machine-readable chemical identifiers.
