Identità
PKCbeta Inhibitor
Non indicato · C24H21N5O2
01Identità
| Lazychem ID | LC-84234 |
|---|---|
| CAS RN | Non indicato |
| PubChem CID | 6419755 |
| Molecular formula | C24H21N5O2 |
| Molecular weight | 411.5 g/mol |
| IUPAC name | 3-anilino-4-[1-(3-imidazol-1-ylpropyl)indol-3-yl]pyrrole-2,5-dione |
| InChIKey | KIWODJBCHRADND-UHFFFAOYSA-N |
02Struttura e stereochimica
2D structurePubChem CID 6419755
The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 1 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C(C=C1)NC2=C(C(=O)NC2=O)C3=CN(C4=CC=CC=C43)CCCN5C=CN=C5 |
|---|---|
| InChI | Non indicato |
03Stato in India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomi e relazioni
API e farmaco progenitore
Non indicato
Nomi e relazioni
05Fonti
- S01PubChem CID 6419755
Structure and machine-readable chemical identifiers.