Identità
Calcium pyruvate
Non indicato · C6H6CaO6
01Identità
| Lazychem ID | LC-81834 |
|---|---|
| CAS RN | Non indicato |
| PubChem CID | 9859191 |
| Molecular formula | C6H6CaO6 |
| Molecular weight | 214.19 g/mol |
| IUPAC name | calcium bis(2-oxopropanoate) |
| InChIKey | UZWMCCLZMHPPKW-UHFFFAOYSA-L |
02Struttura e stereochimica
2D structurePubChem CID 9859191

The parsed structure is acyclic, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 0 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC(=O)C(=O)[O-].CC(=O)C(=O)[O-].[Ca+2] |
|---|---|
| InChI | Non indicato |
03Stato in India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomi e relazioni
API e farmaco progenitore
Non indicato
Nomi e relazioni
05Fonti
- S01PubChem CID 9859191
Structure and machine-readable chemical identifiers.
