Identità
6-Fluoroquinolin-2-amine
Non indicato · C9H7FN2
01Identità
| Lazychem ID | LC-77525 |
|---|---|
| CAS RN | Non indicato |
| PubChem CID | 11400948 |
| Molecular formula | C9H7FN2 |
| Molecular weight | 162.16 g/mol |
| IUPAC name | 6-fluoroquinolin-2-amine |
| InChIKey | DSROYDXRWJWKRT-UHFFFAOYSA-N |
02Struttura e stereochimica
2D structurePubChem CID 11400948

The parsed structure contains 2 rings, includes aromatic atoms, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC2=C(C=CC(=N2)N)C=C1F |
|---|---|
| InChI | Non indicato |
03Stato in India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomi e relazioni
API e farmaco progenitore
Non indicato
Nomi e relazioni
05Fonti
- S01PubChem CID 11400948
Structure and machine-readable chemical identifiers.
