Identità
PHA-767491 hydrochloride
Non indicato · C12H12ClN3O
01Identità
| Lazychem ID | LC-76640 |
|---|---|
| CAS RN | Non indicato |
| PubChem CID | 11715766 |
| Molecular formula | C12H12ClN3O |
| Molecular weight | 249.69 g/mol |
| IUPAC name | 2-pyridin-4-yl-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one;hydrochloride |
| InChIKey | IMVNFURYBZMFDZ-UHFFFAOYSA-N |
02Struttura e stereochimica
2D structurePubChem CID 11715766

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1CNC(=O)C2=C1NC(=C2)C3=CC=NC=C3.Cl |
|---|---|
| InChI | Non indicato |
03Stato in India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomi e relazioni
API e farmaco progenitore
Non indicato
Nomi e relazioni
05Fonti
- S01PubChem CID 11715766
Structure and machine-readable chemical identifiers.
