Identità
Pexidartinib
Non indicato · C20H15ClF3N5
01Identità
| Lazychem ID | LC-63370 |
|---|---|
| CAS RN | Non indicato |
| PubChem CID | 25151352 |
| Molecular formula | C20H15ClF3N5 |
| Molecular weight | 417.8 g/mol |
| IUPAC name | 5-[(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyridin-2-amine |
| InChIKey | JGWRKYUXBBNENE-UHFFFAOYSA-N |
02Struttura e stereochimica
2D structurePubChem CID 25151352
The parsed structure contains 4 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 1 |
| Tertiary amines | 0 |
| SMILES | C1=CC(=NC=C1CC2=CNC3=C2C=C(C=N3)Cl)NCC4=CN=C(C=C4)C(F)(F)F |
|---|---|
| InChI | Non indicato |
03Stato in India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomi e relazioni
API e farmaco progenitore
Non indicato
Nomi e relazioni
05Fonti
- S01PubChem CID 25151352
Structure and machine-readable chemical identifiers.