Identità
13-cis Acitretin-d3
Non indicato · C21H26O3
01Identità
| Lazychem ID | LC-40966 |
|---|---|
| CAS RN | Non indicato |
| PubChem CID | 46780079 |
| Molecular formula | C21H26O3 |
| Molecular weight | 329.4 g/mol |
| IUPAC name | (2Z,4E,6E,8E)-3,7-dimethyl-9-[2,3,6-trimethyl-4-(trideuteriomethoxy)phenyl]nona-2,4,6,8-tetraenoic acid |
| InChIKey | IHUNBGSDBOWDMA-ZHGFVQCVSA-N |
02Struttura e stereochimica
2D structurePubChem CID 46780079

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | [2H]C([2H])([2H])OC1=C(C(=C(C(=C1)C)/C=C/C(=C/C=C/C(=C\C(=O)O)/C)/C)C)C |
|---|---|
| InChI | Non indicato |
03Stato in India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomi e relazioni
API e farmaco progenitore
Non indicato
Nomi e relazioni
05Fonti
- S01PubChem CID 46780079
Structure and machine-readable chemical identifiers.
