Identità
Cy5 NHS Ester
Non indicato · C37H43N3O10S2
01Identità
| Lazychem ID | LC-35660 |
|---|---|
| CAS RN | Non indicato |
| PubChem CID | 126969923 |
| Molecular formula | C37H43N3O10S2 |
| Molecular weight | 753.9 g/mol |
| IUPAC name | 2-[5-[1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-3,3-dimethyl-5-sulfoindol-1-ium-2-yl]penta-2,4-dienylidene]-1-ethyl-3,3-dimethylindole-5-sulfonate |
| InChIKey | WXWLHDCCGVWTDZ-UHFFFAOYSA-N |
02Struttura e stereochimica
2D structurePubChem CID 126969923

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CCN1C2=C(C=C(C=C2)S(=O)(=O)[O-])C(C1=CC=CC=CC3=[N+](C4=C(C3(C)C)C=C(C=C4)S(=O)(=O)O)CCCCCC(=O)ON5C(=O)CCC5=O)(C)C |
|---|---|
| InChI | Non indicato |
03Stato in India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomi e relazioni
API e farmaco progenitore
Non indicato
Nomi e relazioni
05Fonti
- S01PubChem CID 126969923
Structure and machine-readable chemical identifiers.
