Identità
(Perfluorohexyl)ethylene
Non indicato · C8H3F13
01Identità
| Lazychem ID | LC-118504 |
|---|---|
| CAS RN | Non indicato |
| PubChem CID | 91384 |
| Molecular formula | C8H3F13 |
| Molecular weight | 346.09 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooct-1-ene |
| InChIKey | FYQFWFHDPNXORA-UHFFFAOYSA-N |
02Struttura e stereochimica
2D structurePubChem CID 91384

The parsed structure is acyclic, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 0 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C=CC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
|---|---|
| InChI | Non indicato |
03Stato in India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomi e relazioni
API e farmaco progenitore
Non indicato
Nomi e relazioni
05Fonti
- S01PubChem CID 91384
Structure and machine-readable chemical identifiers.
