Identità
Cimicoxib
Non indicato · C16H13ClFN3O3S
01Identità
| Lazychem ID | LC-112358 |
|---|---|
| CAS RN | Non indicato |
| PubChem CID | 213053 |
| Molecular formula | C16H13ClFN3O3S |
| Molecular weight | 381.8 g/mol |
| IUPAC name | 4-[4-chloro-5-(3-fluoro-4-methoxyphenyl)imidazol-1-yl]benzenesulfonamide |
| InChIKey | KYXDNECMRLFQMZ-UHFFFAOYSA-N |
02Struttura e stereochimica
2D structurePubChem CID 213053
The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | COC1=C(C=C(C=C1)C2=C(N=CN2C3=CC=C(C=C3)S(=O)(=O)N)Cl)F |
|---|---|
| InChI | Non indicato |
03Stato in India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomi e relazioni
API e farmaco progenitore
Non indicato
Nomi e relazioni
05Fonti
- S01PubChem CID 213053
Structure and machine-readable chemical identifiers.