Identità
6961-49-5
Non indicato · C8H8ClNO2
01Identità
| Lazychem ID | LC-110943 |
|---|---|
| CAS RN | Non indicato |
| PubChem CID | 247831 |
| Molecular formula | C8H8ClNO2 |
| Molecular weight | 185.61 g/mol |
| IUPAC name | 2-(2-chloroanilino)acetic acid |
| InChIKey | NSDVLRONTCKCPY-UHFFFAOYSA-N |
02Struttura e stereochimica
2D structurePubChem CID 247831

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 1 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C(C(=C1)NCC(=O)O)Cl |
|---|---|
| InChI | Non indicato |
03Stato in India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomi e relazioni
API e farmaco progenitore
Non indicato
Nomi e relazioni
05Fonti
- S01PubChem CID 247831
Structure and machine-readable chemical identifiers.
