Identità
3'-Chloro-4'-methoxyacetophenone
Non indicato · C9H9ClO2
01Identità
| Lazychem ID | LC-106740 |
|---|---|
| CAS RN | Non indicato |
| PubChem CID | 520857 |
| Molecular formula | C9H9ClO2 |
| Molecular weight | 184.62 g/mol |
| IUPAC name | 1-(3-chloro-4-methoxyphenyl)ethanone |
| InChIKey | QILWOKAXHOAFOF-UHFFFAOYSA-N |
02Struttura e stereochimica
2D structurePubChem CID 520857

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC(=O)C1=CC(=C(C=C1)OC)Cl |
|---|---|
| InChI | Non indicato |
03Stato in India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nomi e relazioni
API e farmaco progenitore
Non indicato
Nomi e relazioni
05Fonti
- S01PubChem CID 520857
Structure and machine-readable chemical identifiers.
