Azonosítás
2-(4-Fluorophenoxy)-3-nitropyridine
Nincs megadva · C11H7FN2O3
01Azonosítás
| Lazychem ID | LC-95462 |
|---|---|
| CAS RN | Nincs megadva |
| PubChem CID | 2737458 |
| Molecular formula | C11H7FN2O3 |
| Molecular weight | 234.18 g/mol |
| IUPAC name | 2-(4-fluorophenoxy)-3-nitropyridine |
| InChIKey | CCUGBHTWDHSEOA-UHFFFAOYSA-N |
02Szerkezet és sztereokémia
2D structurePubChem CID 2737458

The parsed structure contains 2 rings, includes aromatic atoms, contains at least one halogen atom, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC(=C(N=C1)OC2=CC=C(C=C2)F)[N+](=O)[O-] |
|---|---|
| InChI | Nincs megadva |
03Indiai státusz
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nevek és kapcsolatok
API és anyavegyület
Nincs megadva
Nevek és kapcsolatok
05Források
- S01PubChem CID 2737458
Structure and machine-readable chemical identifiers.
