Azonosítás
SB 258585
Nincs megadva · C18H22IN3O3S
01Azonosítás
| Lazychem ID | LC-89274 |
|---|---|
| CAS RN | Nincs megadva |
| PubChem CID | 3248571 |
| Molecular formula | C18H22IN3O3S |
| Molecular weight | 487.4 g/mol |
| IUPAC name | 4-iodo-N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]benzenesulfonamide |
| InChIKey | BDHMSYNBSBZCAF-UHFFFAOYSA-N |
02Szerkezet és sztereokémia
2D structurePubChem CID 3248571

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 2 |
| SMILES | CN1CCN(CC1)C2=C(C=CC(=C2)NS(=O)(=O)C3=CC=C(C=C3)I)OC |
|---|---|
| InChI | Nincs megadva |
03Indiai státusz
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nevek és kapcsolatok
API és anyavegyület
Nincs megadva
Nevek és kapcsolatok
05Források
- S01PubChem CID 3248571
Structure and machine-readable chemical identifiers.
