Azonosítás
Coenzyme Q7
Nincs megadva · C44H66O4
01Azonosítás
| Lazychem ID | LC-49032 |
|---|---|
| CAS RN | Nincs megadva |
| PubChem CID | 5289540 |
| Molecular formula | C44H66O4 |
| Molecular weight | 659.0 g/mol |
| IUPAC name | 2-[(2E,6E,10E,14E,18E,22E)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaenyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
| InChIKey | DBESHHFMIFSNRV-RJYQSXAYSA-N |
02Szerkezet és sztereokémia
2D structurePubChem CID 5289540

The parsed structure contains 1 ring, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=C(C(=O)C(=C(C1=O)OC)OC)C/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C |
|---|---|
| InChI | Nincs megadva |
03Indiai státusz
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nevek és kapcsolatok
API és anyavegyület
Nincs megadva
Nevek és kapcsolatok
05Források
- S01PubChem CID 5289540
Structure and machine-readable chemical identifiers.
