
Azonosítás
Cefcapene Impurity 7
Nincs megadva · C17H19N5O6S2
01Azonosítás
| Lazychem ID | LC-40593 |
|---|---|
| CAS RN | Nincs megadva |
| PubChem CID | 53420943 |
| Molecular formula | C17H19N5O6S2 |
| Molecular weight | 453.5 g/mol |
| IUPAC name | 7-[2-(2-amino-1,3-thiazol-4-yl)pent-2-enoylamino]-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | HJJRIJDTIPFROI-UHFFFAOYSA-N |
02Szerkezet és sztereokémia

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CCC=C(C1=CSC(=N1)N)C(=O)NC2C3N(C2=O)C(=C(CS3)COC(=O)N)C(=O)O |
|---|---|
| InChI | Nincs megadva |
03Stereochemistry
The published structure contains 0 defined and 2 unassigned tetrahedral stereocentres. The exact wedge and dash depiction is shown above.
Published same-connectivity configurations
3 recordsThese records have the same connectivity, molecular formula and protonation layer, but a different complete InChIKey stereochemical layer. Only separately structure-linked records are shown.

![Two-dimensional chemical structure of (6R,7R)-7-[[(E)-2-(2-amino-1,3-thiazol-4-yl)pent-2-enoyl]amino]-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid](/structures/pubchem/6448836-300.png)
(6R,7R)-7-[[(E)-2-(2-amino-1,3-thiazol-4-yl)pent-2-enoyl]amino]-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
CAS not listed
HJJRIJDTIPFROI-NLFPIMAYSA-N
2 defined, 0 unassigned centres

Scope: The mathematical 2^n value is only an upper bound. Symmetry and other stereogenic elements can change the number of distinct stereoisomers. A hypothetical configuration is not published as a compound record without a verified structure identity.
04Indiai státusz
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
05Nevek és kapcsolatok
API és anyavegyület
Nincs megadva
Nevek és kapcsolatok
06Források
- S01PubChem CID 53420943
Structure and machine-readable chemical identifiers.
