Azonosítás
Apixaban Impurity 53
Nincs megadva · C28H26N6O4
01Azonosítás
| Lazychem ID | LC-33985 |
|---|---|
| CAS RN | Nincs megadva |
| PubChem CID | 146538119 |
| Molecular formula | C28H26N6O4 |
| Molecular weight | 510.5 g/mol |
| IUPAC name | 3-(imidazole-1-carbonyl)-1-(4-methoxyphenyl)-6-[4-(2-oxopiperidin-1-yl)phenyl]-4,5-dihydropyrazolo[5,4-c]pyridin-7-one |
| InChIKey | JAAQSWSZUFQQAL-UHFFFAOYSA-N |
02Szerkezet és sztereokémia
2D structurePubChem CID 146538119

The parsed structure contains 6 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 6 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | COC1=CC=C(C=C1)N2C3=C(CCN(C3=O)C4=CC=C(C=C4)N5CCCCC5=O)C(=N2)C(=O)N6C=CN=C6 |
|---|---|
| InChI | Nincs megadva |
03Indiai státusz
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nevek és kapcsolatok
API és anyavegyület
Nincs megadva
Nevek és kapcsolatok
05Források
- S01PubChem CID 146538119
Structure and machine-readable chemical identifiers.
