Identitet
Almotriptan malate impurity E [EP impurity]
Nije navedeno · C17H25N3O3S
01Identitet
| Lazychem ID | LC-41517 |
|---|---|
| CAS RN | Nije navedeno |
| PubChem CID | 29971323 |
| Molecular formula | C17H25N3O3S |
| Molecular weight | 351.5 g/mol |
| IUPAC name | N,N-dimethyl-2-[5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indol-3-yl]ethanamine oxide |
| InChIKey | OSEGVGYYPORWLQ-UHFFFAOYSA-N |
02Struktura i stereokemija
2D structurePubChem CID 29971323
![Two-dimensional chemical structure of Almotriptan malate impurity E [EP impurity]](/structures/pubchem/29971323-900.png)
The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C[N+](C)(CCC1=CNC2=C1C=C(C=C2)CS(=O)(=O)N3CCCC3)[O-] |
|---|---|
| InChI | Nije navedeno |
03Status u Indiji
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nazivi i povezanosti
API i matični lijek
Nije navedeno
Nazivi i povezanosti
05Izvori
- S01PubChem CID 29971323
Structure and machine-readable chemical identifiers.
