पहचान
Dapsone Dimer Impurity
CAS 2514651-21-7 · C24H22N4O4S2
01पहचान
| Lazychem ID | LC-11960 |
|---|---|
| CAS RN | 2514651-21-7 |
| PubChem CID | 125345696 |
| Molecular formula | C24H22N4O4S2 |
| Molecular weight | 494.59 g/mol |
| IUPAC name | 4,4'-(4,4'-(hydrazine-1,2-diyl)bis(4,1-phenylenesulfonyl))dianiline |
| InChIKey | QWQRSTQAPKEYDM-UHFFFAOYSA-N |
02संरचना और त्रिविम रसायन
2D structurePubChem CID 125345696

The parsed structure contains 4 rings, includes aromatic atoms. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 2 |
| Tertiary amines | 0 |
| SMILES | NC1=CC=C(C=C1)S(C2=CC=C(C=C2)NNC3=CC=C(C=C3)S(C4=CC=C(C=C4)N)(=O)=O)(=O)=O |
|---|---|
| InChI | सूचीबद्ध नहीं |
03भारत में स्थिति
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04नाम और संबंध
API और मूल औषधि
Dapsone
अशुद्धियाँ और संबंधित यौगिकनाम और संबंध
- 4,4’-Bis(p-aminobenzenesulfonyl)hydrazobenzene
05स्रोत
- S01PubChem CID 125345696
Structure and machine-readable chemical identifiers.
