पहचान
Cebranopadol
सूचीबद्ध नहीं · C24H27FN2O
01पहचान
| Lazychem ID | LC-76273 |
|---|---|
| CAS RN | सूचीबद्ध नहीं |
| PubChem CID | 11848225 |
| Molecular formula | C24H27FN2O |
| Molecular weight | 378.5 g/mol |
| IUPAC name | 6-fluoro-N,N-dimethyl-1'-phenylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine |
| InChIKey | CSMVOZKEWSOFER-UHFFFAOYSA-N |
02संरचना और त्रिविम रसायन
2D structurePubChem CID 11848225

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CN(C)C1(CCC2(CC1)C3=C(CCO2)C4=C(N3)C=CC(=C4)F)C5=CC=CC=C5 |
|---|---|
| InChI | सूचीबद्ध नहीं |
03भारत में स्थिति
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04नाम और संबंध
API और मूल औषधि
सूचीबद्ध नहीं
नाम और संबंध
05स्रोत
- S01PubChem CID 11848225
Structure and machine-readable chemical identifiers.
