पहचान
Xav-939
सूचीबद्ध नहीं · C14H11F3N2OS
01पहचान
| Lazychem ID | LC-55156 |
|---|---|
| CAS RN | सूचीबद्ध नहीं |
| PubChem CID | 135418940 |
| Molecular formula | C14H11F3N2OS |
| Molecular weight | 312.31 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-4-one |
| InChIKey | KLGQSVMIPOVQAX-UHFFFAOYSA-N |
02संरचना और त्रिविम रसायन
2D structurePubChem CID 135418940

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1CSCC2=C1N=C(NC2=O)C3=CC=C(C=C3)C(F)(F)F |
|---|---|
| InChI | सूचीबद्ध नहीं |
03भारत में स्थिति
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04नाम और संबंध
API और मूल औषधि
सूचीबद्ध नहीं
नाम और संबंध
05स्रोत
- S01PubChem CID 135418940
Structure and machine-readable chemical identifiers.
