पहचान
Chloranil
सूचीबद्ध नहीं · C6Cl4O2
01पहचान
| Lazychem ID | LC-54227 |
|---|---|
| CAS RN | सूचीबद्ध नहीं |
| PubChem CID | 8371 |
| Molecular formula | C6Cl4O2 |
| Molecular weight | 245.9 g/mol |
| IUPAC name | 2,3,5,6-tetrachlorocyclohexa-2,5-diene-1,4-dione |
| InChIKey | UGNWTBMOAKPKBL-UHFFFAOYSA-N |
02संरचना और त्रिविम रसायन
2D structurePubChem CID 8371

The parsed structure contains 1 ring, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1(=C(C(=O)C(=C(C1=O)Cl)Cl)Cl)Cl |
|---|---|
| InChI | सूचीबद्ध नहीं |
03भारत में स्थिति
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04नाम और संबंध
API और मूल औषधि
सूचीबद्ध नहीं
नाम और संबंध
05स्रोत
- S01PubChem CID 8371
Structure and machine-readable chemical identifiers.
