
पहचान
Dextrorphan-d3
सूचीबद्ध नहीं · C17H23NO
01पहचान
| Lazychem ID | LC-45531 |
|---|---|
| CAS RN | सूचीबद्ध नहीं |
| PubChem CID | 12116690 |
| Molecular formula | C17H23NO |
| Molecular weight | 260.39 g/mol |
| IUPAC name | (1S,9S,10S)-17-(trideuteriomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
| InChIKey | JAQUASYNZVUNQP-PGDUQUMKSA-N |
02संरचना और त्रिविम रसायन

The parsed structure contains 4 rings, includes aromatic atoms, includes aliphatic carbon, has 3 defined stereocentres. These statements are calculated from the published structure string.
| Defined stereocentres | 3 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | [2H]C([2H])([2H])N1CC[C@@]23CCCC[C@@H]2[C@@H]1CC4=C3C=C(C=C4)O |
|---|---|
| InChI | सूचीबद्ध नहीं |
03Stereochemistry
The published structure contains 3 defined and 0 unassigned tetrahedral stereocentres. The exact wedge and dash depiction is shown above.
Published same-connectivity configurations
2 recordsThese records have the same connectivity, molecular formula and protonation layer, but a different complete InChIKey stereochemical layer. Only separately structure-linked records are shown.


Dextromethorphan EP Impurity B
CAS 125-73-5
JAQUASYNZVUNQP-PVAVHDDUSA-N
3 defined, 0 unassigned centres
Scope: The mathematical 2^n value is only an upper bound. Symmetry and other stereogenic elements can change the number of distinct stereoisomers. A hypothetical configuration is not published as a compound record without a verified structure identity.
04भारत में स्थिति
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
05नाम और संबंध
API और मूल औषधि
सूचीबद्ध नहीं
नाम और संबंध
06स्रोत
- S01PubChem CID 12116690
Structure and machine-readable chemical identifiers.
