
पहचान
Dutasteride EP Impurity B
सूचीबद्ध नहीं · C21H32N2O2
01पहचान
| Lazychem ID | LC-33841 |
|---|---|
| CAS RN | सूचीबद्ध नहीं |
| PubChem CID | 154584899 |
| Molecular formula | C21H32N2O2 |
| Molecular weight | 344.5 g/mol |
| IUPAC name | (1S,3aS,3bS,5aR,9aR,9bS,11aS)-N,N,9a,11a-tetramethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxamide |
| InChIKey | FGCFOECTPSWPGU-ICVGDBTHSA-N |
02संरचना और त्रिविम रसायन

The parsed structure contains 4 rings, includes aliphatic carbon, has 7 defined stereocentres. These statements are calculated from the published structure string.
| Defined stereocentres | 7 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2C(=O)N(C)C)CC[C@@H]4[C@@]3(C=CC(=O)N4)C |
|---|---|
| InChI | सूचीबद्ध नहीं |
03Stereochemistry
The published structure contains 7 defined and 0 unassigned tetrahedral stereocentres. The exact wedge and dash depiction is shown above.
Published same-connectivity configurations
2 recordsThese records have the same connectivity, molecular formula and protonation layer, but a different complete InChIKey stereochemical layer. Only separately structure-linked records are shown.


Dutasteride EP Impurity B / Dutasteride Dimethylamide
CAS 2512195-98-9
FGCFOECTPSWPGU-FKLRSJPUSA-N
4 defined, 3 unassigned centres
Scope: The mathematical 2^n value is only an upper bound. Symmetry and other stereogenic elements can change the number of distinct stereoisomers. A hypothetical configuration is not published as a compound record without a verified structure identity.
04भारत में स्थिति
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
05नाम और संबंध
API और मूल औषधि
सूचीबद्ध नहीं
नाम और संबंध
06स्रोत
- S01PubChem CID 154584899
Structure and machine-readable chemical identifiers.
