Aitheantas
Selectfluor
Gan liostú · C7H14B2ClF9N2
01Aitheantas
| Lazychem ID | LC-97227 |
|---|---|
| CAS RN | Gan liostú |
| PubChem CID | 2724933 |
| Molecular formula | C7H14B2ClF9N2 |
| Molecular weight | 354.3 g/mol |
| IUPAC name | 1-(chloromethyl)-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane ditetrafluoroborate |
| InChIKey | TXRPHPUGYLSHCX-UHFFFAOYSA-N |
02Struchtúr agus steiréicheimic
2D structurePubChem CID 2724933

The parsed structure contains 3 rings, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | [B-](F)(F)(F)F.[B-](F)(F)(F)F.C1C[N+]2(CC[N+]1(CC2)CCl)F |
|---|---|
| InChI | Gan liostú |
03Stádas san India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ainmneacha agus gaolta
API agus máthairdhruga
Gan liostú
Ainmneacha agus gaolta
05Foinsí
- S01PubChem CID 2724933
Structure and machine-readable chemical identifiers.
