Aitheantas
Nitecapone
Gan liostú · C12H11NO6
01Aitheantas
| Lazychem ID | LC-84621 |
|---|---|
| CAS RN | Gan liostú |
| PubChem CID | 5464105 |
| Molecular formula | C12H11NO6 |
| Molecular weight | 265.22 g/mol |
| IUPAC name | 3-[(3,4-dihydroxy-5-nitrophenyl)methylidene]pentane-2,4-dione |
| InChIKey | UPMRZALMHVUCIN-UHFFFAOYSA-N |
02Struchtúr agus steiréicheimic
2D structurePubChem CID 5464105

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC(=O)C(=CC1=CC(=C(C(=C1)O)O)[N+](=O)[O-])C(=O)C |
|---|---|
| InChI | Gan liostú |
03Stádas san India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ainmneacha agus gaolta
API agus máthairdhruga
Gan liostú
Ainmneacha agus gaolta
05Foinsí
- S01PubChem CID 5464105
Structure and machine-readable chemical identifiers.
