Aitheantas
Taladegib
Gan liostú · C26H24F4N6O
01Aitheantas
| Lazychem ID | LC-59220 |
|---|---|
| CAS RN | Gan liostú |
| PubChem CID | 49848070 |
| Molecular formula | C26H24F4N6O |
| Molecular weight | 512.5 g/mol |
| IUPAC name | 4-fluoro-N-methyl-N-[1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-yl]-2-(trifluoromethyl)benzamide |
| InChIKey | SZBGQDXLNMELTB-UHFFFAOYSA-N |
02Struchtúr agus steiréicheimic
2D structurePubChem CID 49848070

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CN1C(=CC=N1)C2=NN=C(C3=CC=CC=C32)N4CCC(CC4)N(C)C(=O)C5=C(C=C(C=C5)F)C(F)(F)F |
|---|---|
| InChI | Gan liostú |
03Stádas san India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ainmneacha agus gaolta
API agus máthairdhruga
Gan liostú
Ainmneacha agus gaolta
05Foinsí
- S01PubChem CID 49848070
Structure and machine-readable chemical identifiers.
