Aitheantas
Risperidone Pyrimidinone-N-oxide(Risperidone impurity)
Gan liostú · C23H27FN4O3
01Aitheantas
| Lazychem ID | LC-40115 |
|---|---|
| CAS RN | Gan liostú |
| PubChem CID | 56833719 |
| Molecular formula | C23H27FN4O3 |
| Molecular weight | 426.5 g/mol |
| IUPAC name | 3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-methyl-1-oxido-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-1-ium-4-one |
| InChIKey | KDVKWCIHWLGWLD-UHFFFAOYSA-N |
02Struchtúr agus steiréicheimic
2D structurePubChem CID 56833719

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CC1=C(C(=O)N2CCCCC2=[N+]1[O-])CCN3CCC(CC3)C4=NOC5=C4C=CC(=C5)F |
|---|---|
| InChI | Gan liostú |
03Stádas san India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ainmneacha agus gaolta
API agus máthairdhruga
Gan liostú
Ainmneacha agus gaolta
05Foinsí
- S01PubChem CID 56833719
Structure and machine-readable chemical identifiers.
