Aitheantas
Toremifene N-Oxide
Gan liostú · C26H28ClNO2
01Aitheantas
| Lazychem ID | LC-36388 |
|---|---|
| CAS RN | Gan liostú |
| PubChem CID | 101919680 |
| Molecular formula | C26H28ClNO2 |
| Molecular weight | 422.0 g/mol |
| IUPAC name | 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine oxide |
| InChIKey | KDHIASPFJAGSRF-QPLCGJKRSA-N |
02Struchtúr agus steiréicheimic
2D structurePubChem CID 101919680

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C[N+](C)(CCOC1=CC=C(C=C1)/C(=C(/CCCl)\C2=CC=CC=C2)/C3=CC=CC=C3)[O-] |
|---|---|
| InChI | Gan liostú |
03Stádas san India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ainmneacha agus gaolta
API agus máthairdhruga
Gan liostú
Ainmneacha agus gaolta
05Foinsí
- S01PubChem CID 101919680
Structure and machine-readable chemical identifiers.
