Aitheantas
3-Hydroxy-2-quinoxalinepropionic acid
Gan liostú · C11H10N2O3
01Aitheantas
| Lazychem ID | LC-113788 |
|---|---|
| CAS RN | Gan liostú |
| PubChem CID | 151480 |
| Molecular formula | C11H10N2O3 |
| Molecular weight | 218.21 g/mol |
| IUPAC name | 3-(3-oxo-4H-quinoxalin-2-yl)propanoic acid |
| InChIKey | HROJWOXFEZYMGL-UHFFFAOYSA-N |
02Struchtúr agus steiréicheimic
2D structurePubChem CID 151480

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C2C(=C1)NC(=O)C(=N2)CCC(=O)O |
|---|---|
| InChI | Gan liostú |
03Stádas san India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ainmneacha agus gaolta
API agus máthairdhruga
Gan liostú
Ainmneacha agus gaolta
05Foinsí
- S01PubChem CID 151480
Structure and machine-readable chemical identifiers.
