Aitheantas
Sumatriptan Succinate
CAS 1397195-80-0 · C32H48N6O8S2
01Aitheantas
| Lazychem ID | LC-101300 |
|---|---|
| CAS RN | 1397195-80-0 |
| PubChem CID | 131873425 |
| Molecular formula | C32H48N6O8S2 |
| Molecular weight | 721.0 g/mol |
| IUPAC name | bis(1-[3-[2-[bis(trideuteriomethyl)amino]ethyl]-1H-indol-5-yl]-N-methylmethanesulfonamide);butanedioic acid |
| InChIKey | HIMZTGQXEPNRFN-LXRVQIONSA-N |
02Struchtúr agus steiréicheimic
2D structurePubChem CID 131873425

The parsed structure contains 4 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 2 |
| SMILES | [2H]C([2H])([2H])N(CCC1=CNC2=C1C=C(C=C2)CS(=O)(=O)NC)C([2H])([2H])[2H].[2H]C([2H])([2H])N(CCC1=CNC2=C1C=C(C=C2)CS(=O)(=O)NC)C([2H])([2H])[2H].C(CC(=O)O)C(=O)O |
|---|---|
| InChI | Gan liostú |
03Stádas san India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Ainmneacha agus gaolta
API agus máthairdhruga
Gan liostú
Ainmneacha agus gaolta
- 1397195-80-0
- 3-[2-[di(methyl-d3)amino]ethyl]-N-methyl-1H-indole-5-methanesulfonamide, butanedioic acid (2:1)
- 1-[3-[2-[bis(trideuteriomethyl)amino]ethyl]-1H-indol-5-yl]-N-methylmethanesulfonamide
- butanedioic acid
- Sumatriptan (succinate)
- 1-[3-[2-[bis(trideuteriomethyl)amino]ethyl]-1H-indol-5-yl]-N-methyl-methanesulfonamide
- succinic acid
- C32H48N6O8S2
05Foinsí
- S01PubChem CID 131873425
Structure and machine-readable chemical identifiers.
