Tunnistetiedot
Macitentan Impurity B
CAS 2211054-90-7 · C10H8Br2N4O2
01Tunnistetiedot
| Lazychem ID | LC-19421 |
|---|---|
| CAS RN | 2211054-90-7 |
| PubChem CID | 132278565 |
| Molecular formula | C10H8Br2N4O2 |
| Molecular weight | 376.00g/mol |
| IUPAC name | 1, 2-bis ((5-bromopyrimidin-2-yl) oxy) ethane |
| InChIKey | ITCWLFQPBZOBCV-UHFFFAOYSA-N |
02Rakenne ja stereokemia
2D structurePubChem CID 132278565

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=C(C=NC(=N1)OCCOC2=NC=C(C=N2)Br)Br |
|---|---|
| InChI | Ei ilmoitettu |
03Tila Intiassa
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nimet ja suhteet
API ja emolääke
Macitentan
Epäpuhtaudet ja lähiyhdisteetNimet ja suhteet
- Macitentan Impurity 17
- 2211054-90-7
- O,O'-Bis(5-bromopyrimidin-2-yl)glycol
- Macitentan Impurity K
- 1,2-bis((5-bromopyrimidin-2-yl)oxy)ethane
- 2,2'-[ethane-1,2-diylbis(oxy)]bis(5-bromopyrimidine)
05Lähteet
- S01PubChem CID 132278565
Structure and machine-readable chemical identifiers.
