Tunnistetiedot
Hydroxy Flutamide
CAS 52806-53-8 · C11H11F3N2O4
01Tunnistetiedot
| Lazychem ID | LC-16710 |
|---|---|
| CAS RN | 52806-53-8 |
| PubChem CID | 91649 |
| Molecular formula | C11H11F3N2O4 |
| Molecular weight | 292.21 g/mol |
| IUPAC name | 2-Hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
| InChIKey | YPQLFJODEKMJEF-UHFFFAOYSA-N |
02Rakenne ja stereokemia
2D structurePubChem CID 91649

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC(C)(C(=O)NC1=CC(=C(C=C1)[N+](=O)[O-])C(F)(F)F)O |
|---|---|
| InChI | Ei ilmoitettu |
03Tila Intiassa
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nimet ja suhteet
API ja emolääke
Flutamide
Epäpuhtaudet ja lähiyhdisteetNimet ja suhteet
05Lähteet
- S01PubChem CID 91649
Structure and machine-readable chemical identifiers.
