Tunnistetiedot
Acyclic retinoid
Ei ilmoitettu · C20H30O2
01Tunnistetiedot
| Lazychem ID | LC-84112 |
|---|---|
| CAS RN | Ei ilmoitettu |
| PubChem CID | 6437836 |
| Molecular formula | C20H30O2 |
| Molecular weight | 302.5 g/mol |
| IUPAC name | (2E,4E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,4,6,10,14-pentaenoic acid |
| InChIKey | UUBHZHZSIKRVIV-KCXSXWJSSA-N |
02Rakenne ja stereokemia
2D structurePubChem CID 6437836

The parsed structure is acyclic, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 0 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC(=CCC/C(=C/CC/C(=C/C=C/C(=C/C(=O)O)/C)/C)/C)C |
|---|---|
| InChI | Ei ilmoitettu |
03Tila Intiassa
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nimet ja suhteet
API ja emolääke
Ei ilmoitettu
Nimet ja suhteet
05Lähteet
- S01PubChem CID 6437836
Structure and machine-readable chemical identifiers.
