Tunnistetiedot
Palbociclib Isethionate
Ei ilmoitettu · C26H35N7O6S
01Tunnistetiedot
| Lazychem ID | LC-77239 |
|---|---|
| CAS RN | Ei ilmoitettu |
| PubChem CID | 11478676 |
| Molecular formula | C26H35N7O6S |
| Molecular weight | 573.7 g/mol |
| IUPAC name | 6-acetyl-8-cyclopentyl-5-methyl-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrido[2,3-d]pyrimidin-7-one;2-hydroxyethanesulfonic acid |
| InChIKey | LYYVFHRFIJKPOV-UHFFFAOYSA-N |
02Rakenne ja stereokemia
2D structurePubChem CID 11478676

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 2 |
| Tertiary amines | 1 |
| SMILES | CC1=C(C(=O)N(C2=NC(=NC=C12)NC3=NC=C(C=C3)N4CCNCC4)C5CCCC5)C(=O)C.C(CS(=O)(=O)O)O |
|---|---|
| InChI | Ei ilmoitettu |
03Tila Intiassa
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nimet ja suhteet
API ja emolääke
Ei ilmoitettu
Nimet ja suhteet
05Lähteet
- S01PubChem CID 11478676
Structure and machine-readable chemical identifiers.
