Tunnistetiedot
Pipes sodium
Ei ilmoitettu · C8H17N2NaO6S2
01Tunnistetiedot
| Lazychem ID | LC-64321 |
|---|---|
| CAS RN | Ei ilmoitettu |
| PubChem CID | 23670851 |
| Molecular formula | C8H17N2NaO6S2 |
| Molecular weight | 324.4 g/mol |
| IUPAC name | sodium 2-[4-(2-sulfoethyl)piperazin-1-yl]ethanesulfonate |
| InChIKey | OGGAIRCLBMGXCZ-UHFFFAOYSA-M |
02Rakenne ja stereokemia
2D structurePubChem CID 23670851

The parsed structure contains 1 ring, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 2 |
| SMILES | C1CN(CCN1CCS(=O)(=O)O)CCS(=O)(=O)[O-].[Na+] |
|---|---|
| InChI | Ei ilmoitettu |
03Tila Intiassa
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nimet ja suhteet
API ja emolääke
Ei ilmoitettu
Nimet ja suhteet
05Lähteet
- S01PubChem CID 23670851
Structure and machine-readable chemical identifiers.
