Tunnistetiedot
Mln0905
Ei ilmoitettu · C24H25F3N6S
01Tunnistetiedot
| Lazychem ID | LC-60179 |
|---|---|
| CAS RN | Ei ilmoitettu |
| PubChem CID | 46235922 |
| Molecular formula | C24H25F3N6S |
| Molecular weight | 486.6 g/mol |
| IUPAC name | 2-[[5-[3-(dimethylamino)propyl]-2-methyl-3-pyridinyl]amino]-9-(trifluoromethyl)-5,7-dihydropyrimido[5,4-d][1]benzazepine-6-thione |
| InChIKey | CODBZFJPKJDNDT-UHFFFAOYSA-N |
02Rakenne ja stereokemia
2D structurePubChem CID 46235922

The parsed structure contains 4 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 2 |
| Tertiary amines | 1 |
| SMILES | CC1=C(C=C(C=N1)CCCN(C)C)NC2=NC=C3CC(=S)NC4=C(C3=N2)C=CC(=C4)C(F)(F)F |
|---|---|
| InChI | Ei ilmoitettu |
03Tila Intiassa
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nimet ja suhteet
API ja emolääke
Ei ilmoitettu
Nimet ja suhteet
05Lähteet
- S01PubChem CID 46235922
Structure and machine-readable chemical identifiers.
