Tunnistetiedot
Rimonabant
Ei ilmoitettu · C22H21Cl3N4O
01Tunnistetiedot
| Lazychem ID | LC-116468 |
|---|---|
| CAS RN | Ei ilmoitettu |
| PubChem CID | 104850 |
| Molecular formula | C22H21Cl3N4O |
| Molecular weight | 463.8 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide |
| InChIKey | JZCPYUJPEARBJL-UHFFFAOYSA-N |
02Rakenne ja stereokemia
2D structurePubChem CID 104850

The parsed structure contains 4 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CC1=C(N(N=C1C(=O)NN2CCCCC2)C3=C(C=C(C=C3)Cl)Cl)C4=CC=C(C=C4)Cl |
|---|---|
| InChI | Ei ilmoitettu |
03Tila Intiassa
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nimet ja suhteet
API ja emolääke
Ei ilmoitettu
Nimet ja suhteet
05Lähteet
- S01PubChem CID 104850
Structure and machine-readable chemical identifiers.
