Tunnistetiedot
SR 11237
Ei ilmoitettu · C24H28O4
01Tunnistetiedot
| Lazychem ID | LC-115223 |
|---|---|
| CAS RN | Ei ilmoitettu |
| PubChem CID | 127019 |
| Molecular formula | C24H28O4 |
| Molecular weight | 380.5 g/mol |
| IUPAC name | 4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-dioxolan-2-yl]benzoic acid |
| InChIKey | ZZUKALQMHNSWTK-UHFFFAOYSA-N |
02Rakenne ja stereokemia
2D structurePubChem CID 127019

The parsed structure contains 4 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1(CCC(C2=C1C=CC(=C2)C3(OCCO3)C4=CC=C(C=C4)C(=O)O)(C)C)C |
|---|---|
| InChI | Ei ilmoitettu |
03Tila Intiassa
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nimet ja suhteet
API ja emolääke
Ei ilmoitettu
Nimet ja suhteet
05Lähteet
- S01PubChem CID 127019
Structure and machine-readable chemical identifiers.
