Tunnistetiedot
3,4-Dichlorocinnamic acid
Ei ilmoitettu · C9H6Cl2O2
01Tunnistetiedot
| Lazychem ID | LC-103160 |
|---|---|
| CAS RN | Ei ilmoitettu |
| PubChem CID | 688027 |
| Molecular formula | C9H6Cl2O2 |
| Molecular weight | 217.05 g/mol |
| IUPAC name | (E)-3-(3,4-dichlorophenyl)prop-2-enoic acid |
| InChIKey | RRLUFPHCTSFKNR-DUXPYHPUSA-N |
02Rakenne ja stereokemia
2D structurePubChem CID 688027

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)O)Cl)Cl |
|---|---|
| InChI | Ei ilmoitettu |
03Tila Intiassa
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nimet ja suhteet
API ja emolääke
Ei ilmoitettu
Nimet ja suhteet
05Lähteet
- S01PubChem CID 688027
Structure and machine-readable chemical identifiers.
