Tunnistetiedot
Acitretin (API)
CAS 55079-83-9 · C21H26O3
01Tunnistetiedot
| Lazychem ID | LC-04845 |
|---|---|
| CAS RN | 55079-83-9 |
| PubChem CID | 5284513 |
| Molecular formula | C21H26O3 |
| Molecular weight | 326.44 g/mol |
| IUPAC name | (2E,4E,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
| InChIKey | IHUNBGSDBOWDMA-AQFIFDHZSA-N |
02Rakenne ja stereokemia
2D structurePubChem CID 5284513

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=CC(=C(C(=C1/C=C/C(=C/C=C/C(=C/C(=O)O)/C)/C)C)C)OC |
|---|---|
| InChI | Ei ilmoitettu |
03Tila Intiassa
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nimet ja suhteet
API ja emolääke
Acitretin
Epäpuhtaudet ja lähiyhdisteetNimet ja suhteet
- Acitretin
- 55079-83-9
- Etretin
- Soriatane
- Neotigason
- Acitretine
- Acitretina
- (2E,4E,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid
- Ro 10-1670
- Ro 10-1670/000
- (all-E)-9-(4-Methoxy-2,3,6-trimethylphenyl)-3,7-dimethyl-2,4,6,8-nonatetraenoic acid
- DTXSID6022553
05Lähteet
- S01PubChem CID 5284513
Structure and machine-readable chemical identifiers.
