Identiteet
Nitroso Diallymal
Pole loetletud · C10H11N3O4
01Identiteet
| Lazychem ID | LC-23570 |
|---|---|
| CAS RN | Pole loetletud |
| PubChem CID | 176472956 |
| Molecular formula | C10H11N3O4 |
| Molecular weight | 237.21 g/mol |
| IUPAC name | 5,5-diallyl-1-nitrosopyrimidine-2,4,6(1H,3H,5H)-trione |
| InChIKey | XPUHUQORVUBLFR-UHFFFAOYSA-N |
02Struktuur ja stereokeemia
2D structurePubChem CID 176472956

The parsed structure contains 1 ring, includes aliphatic carbon, contains an N-nitroso substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | O=C1NC(C(CC=C)(CC=C)C(N1N=O)=O)=O |
|---|---|
| InChI | Pole loetletud |
03Staatus Indias
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nimed ja seosed
API ja lähteravim
Diallymal
Lisandid ja seotud ühendidNimed ja seosed
05Allikad
- S01PubChem CID 176472956
Structure and machine-readable chemical identifiers.
