Identiteet
3,4-Dichlorothiobenzamide
Pole loetletud · C7H5Cl2NS
01Identiteet
| Lazychem ID | LC-97896 |
|---|---|
| CAS RN | Pole loetletud |
| PubChem CID | 2060895 |
| Molecular formula | C7H5Cl2NS |
| Molecular weight | 206.09 g/mol |
| IUPAC name | 3,4-dichlorobenzenecarbothioamide |
| InChIKey | FLRBZGVTWSWQNV-UHFFFAOYSA-N |
02Struktuur ja stereokeemia
2D structurePubChem CID 2060895

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC(=C(C=C1C(=S)N)Cl)Cl |
|---|---|
| InChI | Pole loetletud |
03Staatus Indias
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nimed ja seosed
API ja lähteravim
Pole loetletud
Nimed ja seosed
05Allikad
- S01PubChem CID 2060895
Structure and machine-readable chemical identifiers.
