
Identiteet
Guggulsterone
Pole loetletud · C21H28O2
01Identiteet
| Lazychem ID | LC-84068 |
|---|---|
| CAS RN | Pole loetletud |
| PubChem CID | 6450278 |
| Molecular formula | C21H28O2 |
| Molecular weight | 312.4 g/mol |
| IUPAC name | (8R,9S,10R,13S,14S,17Z)-17-ethylidene-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,16-dione |
| InChIKey | WDXRGPWQVHZTQJ-OSJVMJFVSA-N |
02Struktuur ja stereokeemia

The parsed structure contains 4 rings, includes aliphatic carbon, has 5 defined stereocentres. These statements are calculated from the published structure string.
| Defined stereocentres | 5 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C/C=C/1\C(=O)C[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C |
|---|---|
| InChI | Pole loetletud |
03Stereochemistry
The published structure contains 5 defined and 0 unassigned tetrahedral stereocentres. The exact wedge and dash depiction is shown above.
Published same-connectivity configurations
2 recordsThese records have the same connectivity, molecular formula and protonation layer, but a different complete InChIKey stereochemical layer. Only separately structure-linked records are shown.


Scope: The mathematical 2^n value is only an upper bound. Symmetry and other stereogenic elements can change the number of distinct stereoisomers. A hypothetical configuration is not published as a compound record without a verified structure identity.
04Staatus Indias
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
05Nimed ja seosed
API ja lähteravim
Pole loetletud
Nimed ja seosed
06Allikad
- S01PubChem CID 6450278
Structure and machine-readable chemical identifiers.
