Identiteet
Emd-50929
Pole loetletud · C12H8FNO2
01Identiteet
| Lazychem ID | LC-77597 |
|---|---|
| CAS RN | Pole loetletud |
| PubChem CID | 11378949 |
| Molecular formula | C12H8FNO2 |
| Molecular weight | 217.20 g/mol |
| IUPAC name | 5-(4-fluorophenyl)pyridine-3-carboxylic acid |
| InChIKey | KISDAKHYANOMTN-UHFFFAOYSA-N |
02Struktuur ja stereokeemia
2D structurePubChem CID 11378949

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC(=CC=C1C2=CC(=CN=C2)C(=O)O)F |
|---|---|
| InChI | Pole loetletud |
03Staatus Indias
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Nimed ja seosed
API ja lähteravim
Pole loetletud
Nimed ja seosed
05Allikad
- S01PubChem CID 11378949
Structure and machine-readable chemical identifiers.
