
Identiteet
Artemether
Pole loetletud · C16H26O5
01Identiteet
| Lazychem ID | LC-53240 |
|---|---|
| CAS RN | Pole loetletud |
| PubChem CID | 68911 |
| Molecular formula | C16H26O5 |
| Molecular weight | 298.37 g/mol |
| IUPAC name | (1R,4S,5R,8S,9R,10S,12R,13R)-10-methoxy-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| InChIKey | SXYIRMFQILZOAM-HVNFFKDJSA-N |
02Struktuur ja stereokeemia

The parsed structure contains 5 rings, includes aliphatic carbon, has 8 defined stereocentres. These statements are calculated from the published structure string.
| Defined stereocentres | 8 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C[C@@H]1CC[C@H]2[C@H]([C@H](O[C@H]3[C@@]24[C@H]1CC[C@](O3)(OO4)C)OC)C |
|---|---|
| InChI | Pole loetletud |
03Stereochemistry
The published structure contains 8 defined and 0 unassigned tetrahedral stereocentres. The exact wedge and dash depiction is shown above.
Published same-connectivity configurations
2 recordsThese records have the same connectivity, molecular formula and protonation layer, but a different complete InChIKey stereochemical layer. Only separately structure-linked records are shown.


Alpha Artemether/ Artemether Related Compound B
CAS 71939-51-0
SXYIRMFQILZOAM-CNNNLJIRSA-N
8 defined, 0 unassigned centres
Scope: The mathematical 2^n value is only an upper bound. Symmetry and other stereogenic elements can change the number of distinct stereoisomers. A hypothetical configuration is not published as a compound record without a verified structure identity.
04Staatus Indias
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
05Nimed ja seosed
API ja lähteravim
Pole loetletud
Nimed ja seosed
06Allikad
- S01PubChem CID 68911
Structure and machine-readable chemical identifiers.
