
Identiteet
(S)-Pmpa
Pole loetletud · C9H14N5O4P
01Identiteet
| Lazychem ID | LC-52143 |
|---|---|
| CAS RN | Pole loetletud |
| PubChem CID | 122767 |
| Molecular formula | C9H14N5O4P |
| Molecular weight | 287.21 g/mol |
| IUPAC name | [(2S)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid |
| InChIKey | SGOIRFVFHAKUTI-LURJTMIESA-N |
02Struktuur ja stereokeemia

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon, has 1 defined stereocentre. These statements are calculated from the published structure string.
| Defined stereocentres | 1 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C[C@@H](CN1C=NC2=C(N=CN=C21)N)OCP(=O)(O)O |
|---|---|
| InChI | Pole loetletud |
03Stereochemistry
The published structure contains 1 defined and 0 unassigned tetrahedral stereocentre. The exact wedge and dash depiction is shown above.
Published same-connectivity configurations
3 recordsThese records have the same connectivity, molecular formula and protonation layer, but a different complete InChIKey stereochemical layer. Only separately structure-linked records are shown.
Scope: The mathematical 2^n value is only an upper bound. Symmetry and other stereogenic elements can change the number of distinct stereoisomers. A hypothetical configuration is not published as a compound record without a verified structure identity.
04Staatus Indias
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
05Nimed ja seosed
API ja lähteravim
Pole loetletud
Nimed ja seosed
06Allikad
- S01PubChem CID 122767
Structure and machine-readable chemical identifiers.


