
Identiteet
(R)-Warfarin
Pole loetletud · C19H16O4
01Identiteet
| Lazychem ID | LC-40274 |
|---|---|
| CAS RN | Pole loetletud |
| PubChem CID | 54684598 |
| Molecular formula | C19H16O4 |
| Molecular weight | 308.3 g/mol |
| IUPAC name | 4-hydroxy-3-[(1R)-3-oxo-1-phenylbutyl]chromen-2-one |
| InChIKey | PJVWKTKQMONHTI-OAHLLOKOSA-N |
02Struktuur ja stereokeemia

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, has 1 defined stereocentre. These statements are calculated from the published structure string.
| Defined stereocentres | 1 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC(=O)C[C@H](C1=CC=CC=C1)C2=C(C3=CC=CC=C3OC2=O)O |
|---|---|
| InChI | Pole loetletud |
03Stereochemistry
The published structure contains 1 defined and 0 unassigned tetrahedral stereocentre. The exact wedge and dash depiction is shown above.
Published same-connectivity configurations
3 recordsThese records have the same connectivity, molecular formula and protonation layer, but a different complete InChIKey stereochemical layer. Only separately structure-linked records are shown.
Scope: The mathematical 2^n value is only an upper bound. Symmetry and other stereogenic elements can change the number of distinct stereoisomers. A hypothetical configuration is not published as a compound record without a verified structure identity.
04Staatus Indias
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
05Nimed ja seosed
API ja lähteravim
Pole loetletud
Nimed ja seosed
06Allikad
- S01PubChem CID 54684598
Structure and machine-readable chemical identifiers.


