
Identiteet
Beraprost Impurity 66
Pole loetletud · C25H32O5
01Identiteet
| Lazychem ID | LC-38786 |
|---|---|
| CAS RN | Pole loetletud |
| PubChem CID | 69215975 |
| Molecular formula | C25H32O5 |
| Molecular weight | 412.5 g/mol |
| IUPAC name | methyl 4-[2-hydroxy-1-(3-hydroxy-4-methyloct-1-en-6-ynyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoate |
| InChIKey | KJJSQLNNCPOREA-UHFFFAOYSA-N |
02Struktuur ja stereokeemia

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC#CCC(C)C(C=CC1C(CC2C1C3=CC=CC(=C3O2)CCCC(=O)OC)O)O |
|---|---|
| InChI | Pole loetletud |
03Stereochemistry
The published structure contains 0 defined and 6 unassigned tetrahedral stereocentres. The exact wedge and dash depiction is shown above.
Published same-connectivity configurations
2 recordsThese records have the same connectivity, molecular formula and protonation layer, but a different complete InChIKey stereochemical layer. Only separately structure-linked records are shown.

![Two-dimensional chemical structure of Methyl 4-((1R,2R,3aS,8bS)-2-hydroxy-1-((3S,E)-3-hydroxy-4-methyloct-1-en-6-yn-1-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]benzofuran-5-yl)butanoate, CAS 943544-75-0](/structures/pubchem/9909611-300.png)
Methyl 4-((1R,2R,3aS,8bS)-2-hydroxy-1-((3S,E)-3-hydroxy-4-methyloct-1-en-6-yn-1-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]benzofuran-5-yl)butanoate
CAS 943544-75-0
KJJSQLNNCPOREA-FCGLVAOLSA-N
5 defined, 1 unassigned centres
Scope: The mathematical 2^n value is only an upper bound. Symmetry and other stereogenic elements can change the number of distinct stereoisomers. A hypothetical configuration is not published as a compound record without a verified structure identity.
04Staatus Indias
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
05Nimed ja seosed
API ja lähteravim
Pole loetletud
Nimed ja seosed
06Allikad
- S01PubChem CID 69215975
Structure and machine-readable chemical identifiers.
